C9H20O6Si — CID 22114625
2,3,4,5,6-pentahydroxy-1-trimethylsilylhexan-1-one (PubChem CID 22114625) has the molecular formula C9H20O6Si and a molecular weight of 252.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-1-trimethylsilylhexan-1-one.
| Compound Name | 2,3,4,5,6-pentahydroxy-1-trimethylsilylhexan-1-one |
|---|---|
| PubChem CID | 22114625 |
| Molecular Formula | C9H20O6Si |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-1-trimethylsilylhexan-1-one |
| SMILES | C[Si](C)(C)C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C9H20O6Si/c1-16(2,3)9(15)8(14)7(13)6(12)5(11)4-10/h5-8,10-14H,4H2,1-3H3 |
| InChIKey | TYNKHEKALKCUBV-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|