About 3-hydroxybutan-2-ylurea
3-hydroxybutan-2-ylurea (PubChem CID 22114678) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-hydroxybutan-2-ylurea.
Molecular Properties
| Compound Name | 3-hydroxybutan-2-ylurea |
| PubChem CID | 22114678 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 3-hydroxybutan-2-ylurea |
| SMILES | CC(O)C(C)NC(N)=O |
| InChI | InChI=1S/C5H12N2O2/c1-3(4(2)8)7-5(6)9/h3-4,8H,1-2H3,(H3,6,7,9) |
| InChIKey | CDSHGYYXTBWGNU-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxybutan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybutan-2-ylurea?
The IUPAC name of 3-hydroxybutan-2-ylurea (CID 22114678) is 3-hydroxybutan-2-ylurea.
What is the SMILES notation for 3-hydroxybutan-2-ylurea?
The canonical SMILES for 3-hydroxybutan-2-ylurea is CC(O)C(C)NC(N)=O.
What is the InChIKey of 3-hydroxybutan-2-ylurea?
The InChIKey is CDSHGYYXTBWGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-3(4(2)8)7-5(6)9/h3-4,8H,1-2H3,(H3,6,7,9).
What are the key properties of 3-hydroxybutan-2-ylurea?
3-hydroxybutan-2-ylurea has a molecular weight of 132.16 g/mol, XLogP of -0.58, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybutan-2-ylurea is sourced from PubChem (CID 22114678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).