C41H31F3N2O9S — CID 22114809
(2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate (PubChem CID 22114809) has the molecular formula C41H31F3N2O9S and a molecular weight of 784.77 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate.
| Compound Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22114809 |
| Molecular Formula | C41H31F3N2O9S |
| Molecular Weight | 784.77 g/mol |
| Exact Mass | 784.17 |
| IUPAC Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate |
| SMILES | Cc1cc(C(=O)OCc2ccccc2)cc(C)c1OC(=O)c1c2ccccc2[n+](C)c2ccc(CN3C(=O)c4ccccc4C3=O)cc12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C40H31N2O6.CHF3O3S/c1-24-19-28(39(45)47-23-26-11-5-4-6-12-26)20-25(2)36(24)48-40(46)35-31-15-9-10-16-33(31)41(3)34-18-17-27(21-32(34)35)22-42-37(43)29-13-7-8-14-30(29)38(42)44;2-1(3,4)8(5,6)7/h4-21H,22-23H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GFWQWSHTJJQDRY-UHFFFAOYSA-M |
| XLogP | 6.86 |
| TPSA | 151.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.77 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|