C14H22O3 — CID 22114982
(3,6,6-trimethylcyclohex-2-en-1-yl)methyl 3-oxobutanoate (PubChem CID 22114982) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3,6,6-trimethylcyclohex-2-en-1-yl)methyl 3-oxobutanoate.
| Compound Name | (3,6,6-trimethylcyclohex-2-en-1-yl)methyl 3-oxobutanoate |
|---|---|
| PubChem CID | 22114982 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3,6,6-trimethylcyclohex-2-en-1-yl)methyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC1C=C(C)CCC1(C)C |
| InChI | InChI=1S/C14H22O3/c1-10-5-6-14(3,4)12(7-10)9-17-13(16)8-11(2)15/h7,12H,5-6,8-9H2,1-4H3 |
| InChIKey | LQFJZANEWDOQDU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|