C15H12BrClN2O2S — CID 2211503
3-[(4-bromo-2-chlorophenyl)carbamothioylamino]-4-methylbenzoic acid (PubChem CID 2211503) has the molecular formula C15H12BrClN2O2S and a molecular weight of 399.70 g/mol. Its IUPAC name is 3-[(4-bromo-2-chlorophenyl)carbamothioylamino]-4-methylbenzoic acid.
| Compound Name | 3-[(4-bromo-2-chlorophenyl)carbamothioylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 2211503 |
| Molecular Formula | C15H12BrClN2O2S |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 3-[(4-bromo-2-chlorophenyl)carbamothioylamino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=S)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H12BrClN2O2S/c1-8-2-3-9(14(20)21)6-13(8)19-15(22)18-12-5-4-10(16)7-11(12)17/h2-7H,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | WZYHTVHYMPYTDL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|