C10H15N5 — CID 22115526
2-pentylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 22115526) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-pentylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 2-pentylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 22115526 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-pentylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCCCCc1nc(N)n2nccc2n1 |
| InChI | InChI=1S/C10H15N5/c1-2-3-4-5-8-13-9-6-7-12-15(9)10(11)14-8/h6-7H,2-5H2,1H3,(H2,11,13,14) |
| InChIKey | COZVZLGDWGWZRB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|