C16H20O5S — CID 22116319
7-(benzenesulfonylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane (PubChem CID 22116319) has the molecular formula C16H20O5S and a molecular weight of 324.40 g/mol. Its IUPAC name is 7-(benzenesulfonylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane.
| Compound Name | 7-(benzenesulfonylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane |
|---|---|
| PubChem CID | 22116319 |
| Molecular Formula | C16H20O5S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 7-(benzenesulfonylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane |
| SMILES | CC1(CS(=O)(=O)c2ccccc2)OOC2CC1CC1OC21C |
| InChI | InChI=1S/C16H20O5S/c1-15(10-22(17,18)12-6-4-3-5-7-12)11-8-13-16(2,19-13)14(9-11)20-21-15/h3-7,11,13-14H,8-10H2,1-2H3 |
| InChIKey | KAKHQGMAZZZTOA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|