C9H18N2O — CID 22116521
5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentan-2-ol (PubChem CID 22116521) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentan-2-ol.
| Compound Name | 5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 22116521 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentan-2-ol |
| SMILES | CC(O)CCCC1=NCCCN1 |
| InChI | InChI=1S/C9H18N2O/c1-8(12)4-2-5-9-10-6-3-7-11-9/h8,12H,2-7H2,1H3,(H,10,11) |
| InChIKey | GTSWXUHQNHGOBG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |