About [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate
[3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate (PubChem CID 22116748) has the molecular formula C17H20O12
and a molecular weight of 416.34 g/mol. Its IUPAC name is [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate.
Molecular Properties
| Compound Name | [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate |
| PubChem CID | 22116748 |
| Molecular Formula | C17H20O12 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate |
| SMILES | C=COC(=O)OCC(COC(=O)OC=C)(COC(=O)OC=C)COC(=O)OC=C |
| InChI | InChI=1S/C17H20O12/c1-5-22-13(18)26-9-17(10-27-14(19)23-6-2,11-28-15(20)24-7-3)12-29-16(21)25-8-4/h5-8H,1-4,9-12H2 |
| InChIKey | HYEVAOGMPJZMHM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate?
The IUPAC name of [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate (CID 22116748) is [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate.
What is the SMILES notation for [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate?
The canonical SMILES for [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate is C=COC(=O)OCC(COC(=O)OC=C)(COC(=O)OC=C)COC(=O)OC=C.
What is the InChIKey of [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate?
The InChIKey is HYEVAOGMPJZMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O12/c1-5-22-13(18)26-9-17(10-27-14(19)23-6-2,11-28-15(20)24-7-3)12-29-16(21)25-8-4/h5-8H,1-4,9-12H2.
What are the key properties of [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate?
[3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate has a molecular weight of 416.34 g/mol, XLogP of 3.16, 12 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3-ethenoxycarbonyloxy-2,2-bis(ethenoxycarbonyloxymethyl)propyl] ethenyl carbonate is sourced from PubChem (CID 22116748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).