C25H16Cl2N2O4S — CID 22117247
5-[[5-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidenepyrimidin-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 22117247) has the molecular formula C25H16Cl2N2O4S and a molecular weight of 511.39 g/mol. Its IUPAC name is 5-[[5-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidenepyrimidin-1-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[5-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidenepyrimidin-1-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 22117247 |
| Molecular Formula | C25H16Cl2N2O4S |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 5-[[5-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidenepyrimidin-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2cc(C3c4ccc(Cl)cc4C=Cc4cc(Cl)ccc43)c(=S)[nH]c2=O)o1 |
| InChI | InChI=1S/C25H16Cl2N2O4S/c26-15-3-6-18-13(9-15)1-2-14-10-16(27)4-7-19(14)22(18)20-12-29(25(32)28-23(20)34)11-17-5-8-21(33-17)24(30)31/h1-10,12,22H,11H2,(H,30,31)(H,28,32,34) |
| InChIKey | GCCILDHQTAHXNC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|