C17H16O — CID 22117289
6-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one (PubChem CID 22117289) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is 6-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one.
| Compound Name | 6-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 22117289 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 6-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
| SMILES | CCc1ccc2c(c1)CCc1ccccc1C2=O |
| InChI | InChI=1S/C17H16O/c1-2-12-7-10-16-14(11-12)9-8-13-5-3-4-6-15(13)17(16)18/h3-7,10-11H,2,8-9H2,1H3 |
| InChIKey | IZCUACRDEAWBDU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |