C24H25FN2O2 — CID 22117829
2-fluoro-5-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl)benzonitrile (PubChem CID 22117829) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 2-fluoro-5-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl)benzonitrile.
| Compound Name | 2-fluoro-5-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl)benzonitrile |
|---|---|
| PubChem CID | 22117829 |
| Molecular Formula | C24H25FN2O2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-fluoro-5-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl)benzonitrile |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)CC(C)(C)C3)C2c2ccc(F)c(C#N)c2)C1 |
| InChI | InChI=1S/C24H25FN2O2/c1-23(2)8-16-21(18(28)10-23)20(13-5-6-15(25)14(7-13)12-26)22-17(27-16)9-24(3,4)11-19(22)29/h5-7,20-21H,8-11H2,1-4H3 |
| InChIKey | LHLPGMWIARCORY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |