C21H24F3NO — CID 22118079
1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 22118079) has the molecular formula C21H24F3NO and a molecular weight of 363.42 g/mol. Its IUPAC name is 1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 22118079 |
| Molecular Formula | C21H24F3NO |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCCCCCc1ccc(C2CCc3c(cc(F)c(O)c3F)C2)nc1F |
| InChI | InChI=1S/C21H24F3NO/c1-2-3-4-5-6-13-8-10-18(25-21(13)24)14-7-9-16-15(11-14)12-17(22)20(26)19(16)23/h8,10,12,14,26H,2-7,9,11H2,1H3 |
| InChIKey | DHCDHMBWAYXMHL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|