About butan-2-one;N-methylacetamide
butan-2-one;N-methylacetamide (PubChem CID 22118125) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is butan-2-one;N-methylacetamide.
Molecular Properties
| Compound Name | butan-2-one;N-methylacetamide |
| PubChem CID | 22118125 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | butan-2-one;N-methylacetamide |
| SMILES | CCC(C)=O.CNC(C)=O |
| InChI | InChI=1S/C4H8O.C3H7NO/c1-3-4(2)5;1-3(5)4-2/h3H2,1-2H3;1-2H3,(H,4,5) |
| InChIKey | KTKSKPCLGKLXLL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;N-methylacetamide?
The IUPAC name of butan-2-one;N-methylacetamide (CID 22118125) is butan-2-one;N-methylacetamide.
What is the SMILES notation for butan-2-one;N-methylacetamide?
The canonical SMILES for butan-2-one;N-methylacetamide is CCC(C)=O.CNC(C)=O.
What is the InChIKey of butan-2-one;N-methylacetamide?
The InChIKey is KTKSKPCLGKLXLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H7NO/c1-3-4(2)5;1-3(5)4-2/h3H2,1-2H3;1-2H3,(H,4,5).
What are the key properties of butan-2-one;N-methylacetamide?
butan-2-one;N-methylacetamide has a molecular weight of 145.20 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;N-methylacetamide is sourced from PubChem (CID 22118125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).