C4H3F7O2 — CID 22118245
2,2,3,3,4,4,4-heptafluorobutanal;hydrate (PubChem CID 22118245) has the molecular formula C4H3F7O2 and a molecular weight of 216.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutanal;hydrate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutanal;hydrate |
|---|---|
| PubChem CID | 22118245 |
| Molecular Formula | C4H3F7O2 |
| Molecular Weight | 216.05 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanal;hydrate |
| SMILES | O.O=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF7O.H2O/c5-2(6,1-12)3(7,8)4(9,10)11;/h1H;1H2 |
| InChIKey | SIFCGDJQLNEASB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.05 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|