About 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one
3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (PubChem CID 22118279) has the molecular formula C23H31NO3S
and a molecular weight of 401.57 g/mol. Its IUPAC name is 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| PubChem CID | 22118279 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(=O)CCSC2CCCCC2)CO1 |
| InChI | InChI=1S/C23H31NO3S/c1-17-21(18-10-6-4-7-11-18)22(26)24(16-27-17)23(2,3)20(25)14-15-28-19-12-8-5-9-13-19/h4,6-7,10-11,19H,5,8-9,12-16H2,1-3H3 |
| InChIKey | APTPYTSZZNHADE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The IUPAC name of 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (CID 22118279) is 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one is CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(=O)CCSC2CCCCC2)CO1.
What is the InChIKey of 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The InChIKey is APTPYTSZZNHADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO3S/c1-17-21(18-10-6-4-7-11-18)22(26)24(16-27-17)23(2,3)20(25)14-15-28-19-12-8-5-9-13-19/h4,6-7,10-11,19H,5,8-9,12-16H2,1-3H3.
What are the key properties of 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one has a molecular weight of 401.57 g/mol, XLogP of 5.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclohexylsulfanyl-2-methyl-3-oxopentan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 22118279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).