C16H16Cl2N2O4S — CID 22118399
(2-ethylpyrazol-3-yl) 3,4-dichloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate (PubChem CID 22118399) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl) 3,4-dichloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate.
| Compound Name | (2-ethylpyrazol-3-yl) 3,4-dichloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate |
|---|---|
| PubChem CID | 22118399 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (2-ethylpyrazol-3-yl) 3,4-dichloro-5-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carboxylate |
| SMILES | CCn1nccc1OC(=O)c1ccc2c(c1C)C(Cl)C(Cl)CS2(=O)=O |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-3-20-13(6-7-19-20)24-16(21)10-4-5-12-14(9(10)2)15(18)11(17)8-25(12,22)23/h4-7,11,15H,3,8H2,1-2H3 |
| InChIKey | PIIPZEALRKQBHT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|