About 4-chlorocyclohexa-1,3-dien-1-amine
4-chlorocyclohexa-1,3-dien-1-amine (PubChem CID 22118802) has the molecular formula C6H8ClN
and a molecular weight of 129.59 g/mol. Its IUPAC name is 4-chlorocyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-chlorocyclohexa-1,3-dien-1-amine |
| PubChem CID | 22118802 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | 4-chlorocyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC=C(Cl)CC1 |
| InChI | InChI=1S/C6H8ClN/c7-5-1-3-6(8)4-2-5/h1,3H,2,4,8H2 |
| InChIKey | GYOJBRAKHORMEJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chlorocyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorocyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-chlorocyclohexa-1,3-dien-1-amine (CID 22118802) is 4-chlorocyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-chlorocyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-chlorocyclohexa-1,3-dien-1-amine is NC1=CC=C(Cl)CC1.
What is the InChIKey of 4-chlorocyclohexa-1,3-dien-1-amine?
The InChIKey is GYOJBRAKHORMEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN/c7-5-1-3-6(8)4-2-5/h1,3H,2,4,8H2.
What are the key properties of 4-chlorocyclohexa-1,3-dien-1-amine?
4-chlorocyclohexa-1,3-dien-1-amine has a molecular weight of 129.59 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorocyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 22118802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).