About 3-oxo-1,2-dihydroindene-5-sulfonyl chloride
3-oxo-1,2-dihydroindene-5-sulfonyl chloride (PubChem CID 22119022) has the molecular formula C9H7ClO3S
and a molecular weight of 230.67 g/mol. Its IUPAC name is 3-oxo-1,2-dihydroindene-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-oxo-1,2-dihydroindene-5-sulfonyl chloride |
| PubChem CID | 22119022 |
| Molecular Formula | C9H7ClO3S |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 3-oxo-1,2-dihydroindene-5-sulfonyl chloride |
| SMILES | O=C1CCc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C9H7ClO3S/c10-14(12,13)7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5H,2,4H2 |
| InChIKey | LRHGGWRIMQOJLM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxo-1,2-dihydroindene-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-1,2-dihydroindene-5-sulfonyl chloride?
The IUPAC name of 3-oxo-1,2-dihydroindene-5-sulfonyl chloride (CID 22119022) is 3-oxo-1,2-dihydroindene-5-sulfonyl chloride.
What is the SMILES notation for 3-oxo-1,2-dihydroindene-5-sulfonyl chloride?
The canonical SMILES for 3-oxo-1,2-dihydroindene-5-sulfonyl chloride is O=C1CCc2ccc(S(=O)(=O)Cl)cc21.
What is the InChIKey of 3-oxo-1,2-dihydroindene-5-sulfonyl chloride?
The InChIKey is LRHGGWRIMQOJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3S/c10-14(12,13)7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5H,2,4H2.
What are the key properties of 3-oxo-1,2-dihydroindene-5-sulfonyl chloride?
3-oxo-1,2-dihydroindene-5-sulfonyl chloride has a molecular weight of 230.67 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-1,2-dihydroindene-5-sulfonyl chloride is sourced from PubChem (CID 22119022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).