About 3-oxo-1,2-dihydroindene-5-sulfinic acid
3-oxo-1,2-dihydroindene-5-sulfinic acid (PubChem CID 22119038) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 3-oxo-1,2-dihydroindene-5-sulfinic acid.
Molecular Properties
| Compound Name | 3-oxo-1,2-dihydroindene-5-sulfinic acid |
| PubChem CID | 22119038 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 3-oxo-1,2-dihydroindene-5-sulfinic acid |
| SMILES | O=C1CCc2ccc(S(=O)O)cc21 |
| InChI | InChI=1S/C9H8O3S/c10-9-4-2-6-1-3-7(13(11)12)5-8(6)9/h1,3,5H,2,4H2,(H,11,12) |
| InChIKey | ZHHBPTRLWXEQER-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-1,2-dihydroindene-5-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-1,2-dihydroindene-5-sulfinic acid?
The IUPAC name of 3-oxo-1,2-dihydroindene-5-sulfinic acid (CID 22119038) is 3-oxo-1,2-dihydroindene-5-sulfinic acid.
What is the SMILES notation for 3-oxo-1,2-dihydroindene-5-sulfinic acid?
The canonical SMILES for 3-oxo-1,2-dihydroindene-5-sulfinic acid is O=C1CCc2ccc(S(=O)O)cc21.
What is the InChIKey of 3-oxo-1,2-dihydroindene-5-sulfinic acid?
The InChIKey is ZHHBPTRLWXEQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-9-4-2-6-1-3-7(13(11)12)5-8(6)9/h1,3,5H,2,4H2,(H,11,12).
What are the key properties of 3-oxo-1,2-dihydroindene-5-sulfinic acid?
3-oxo-1,2-dihydroindene-5-sulfinic acid has a molecular weight of 196.23 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-1,2-dihydroindene-5-sulfinic acid is sourced from PubChem (CID 22119038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).