About 2-bromo-1-nitropropane-1,3-diol
2-bromo-1-nitropropane-1,3-diol (PubChem CID 22119338) has the molecular formula C3H6BrNO4
and a molecular weight of 199.99 g/mol. Its IUPAC name is 2-bromo-1-nitropropane-1,3-diol.
Molecular Properties
| Compound Name | 2-bromo-1-nitropropane-1,3-diol |
| PubChem CID | 22119338 |
| Molecular Formula | C3H6BrNO4 |
| Molecular Weight | 199.99 g/mol |
| Exact Mass | 198.95 |
| IUPAC Name | 2-bromo-1-nitropropane-1,3-diol |
| SMILES | O=[N+]([O-])C(O)C(Br)CO |
| InChI | InChI=1S/C3H6BrNO4/c4-2(1-6)3(7)5(8)9/h2-3,6-7H,1H2 |
| InChIKey | SRHRIZPRFAUHCX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.99 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-nitropropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-nitropropane-1,3-diol?
The IUPAC name of 2-bromo-1-nitropropane-1,3-diol (CID 22119338) is 2-bromo-1-nitropropane-1,3-diol.
What is the SMILES notation for 2-bromo-1-nitropropane-1,3-diol?
The canonical SMILES for 2-bromo-1-nitropropane-1,3-diol is O=[N+]([O-])C(O)C(Br)CO.
What is the InChIKey of 2-bromo-1-nitropropane-1,3-diol?
The InChIKey is SRHRIZPRFAUHCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrNO4/c4-2(1-6)3(7)5(8)9/h2-3,6-7H,1H2.
What are the key properties of 2-bromo-1-nitropropane-1,3-diol?
2-bromo-1-nitropropane-1,3-diol has a molecular weight of 199.99 g/mol, XLogP of -0.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-nitropropane-1,3-diol is sourced from PubChem (CID 22119338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).