About 3-methyl-1-(1,2,2-trifluoroethenoxy)butane
3-methyl-1-(1,2,2-trifluoroethenoxy)butane (PubChem CID 22119356) has the molecular formula C7H11F3O
and a molecular weight of 168.16 g/mol. Its IUPAC name is 3-methyl-1-(1,2,2-trifluoroethenoxy)butane.
Molecular Properties
| Compound Name | 3-methyl-1-(1,2,2-trifluoroethenoxy)butane |
| PubChem CID | 22119356 |
| Molecular Formula | C7H11F3O |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-methyl-1-(1,2,2-trifluoroethenoxy)butane |
| SMILES | CC(C)CCOC(F)=C(F)F |
| InChI | InChI=1S/C7H11F3O/c1-5(2)3-4-11-7(10)6(8)9/h5H,3-4H2,1-2H3 |
| InChIKey | LVOZZMBXTZMRHE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-(1,2,2-trifluoroethenoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(1,2,2-trifluoroethenoxy)butane?
The IUPAC name of 3-methyl-1-(1,2,2-trifluoroethenoxy)butane (CID 22119356) is 3-methyl-1-(1,2,2-trifluoroethenoxy)butane.
What is the SMILES notation for 3-methyl-1-(1,2,2-trifluoroethenoxy)butane?
The canonical SMILES for 3-methyl-1-(1,2,2-trifluoroethenoxy)butane is CC(C)CCOC(F)=C(F)F.
What is the InChIKey of 3-methyl-1-(1,2,2-trifluoroethenoxy)butane?
The InChIKey is LVOZZMBXTZMRHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3O/c1-5(2)3-4-11-7(10)6(8)9/h5H,3-4H2,1-2H3.
What are the key properties of 3-methyl-1-(1,2,2-trifluoroethenoxy)butane?
3-methyl-1-(1,2,2-trifluoroethenoxy)butane has a molecular weight of 168.16 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(1,2,2-trifluoroethenoxy)butane is sourced from PubChem (CID 22119356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).