About (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol
(1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol (PubChem CID 22119740) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol |
| PubChem CID | 22119740 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol |
| SMILES | C=C(C)C(=O)OC1(CC)CCCC1.C=C(C)c1ccccc1O |
| InChI | InChI=1S/C11H18O2.C9H10O/c1-4-11(7-5-6-8-11)13-10(12)9(2)3;1-7(2)8-5-3-4-6-9(8)10/h2,4-8H2,1,3H3;3-6,10H,1H2,2H3 |
| InChIKey | SDAHLMFBYSXBHR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol?
The IUPAC name of (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol (CID 22119740) is (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol.
What is the SMILES notation for (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol?
The canonical SMILES for (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol is C=C(C)C(=O)OC1(CC)CCCC1.C=C(C)c1ccccc1O.
What is the InChIKey of (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol?
The InChIKey is SDAHLMFBYSXBHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2.C9H10O/c1-4-11(7-5-6-8-11)13-10(12)9(2)3;1-7(2)8-5-3-4-6-9(8)10/h2,4-8H2,1,3H3;3-6,10H,1H2,2H3.
What are the key properties of (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol?
(1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol has a molecular weight of 316.44 g/mol, XLogP of 5.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-methylprop-2-enoate;2-prop-1-en-2-ylphenol is sourced from PubChem (CID 22119740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).