C25H20ClNO5 — CID 22119760
[4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]azanium perchlorate (PubChem CID 22119760) has the molecular formula C25H20ClNO5 and a molecular weight of 449.89 g/mol. Its IUPAC name is [4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]azanium perchlorate.
| Compound Name | [4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]azanium perchlorate |
|---|---|
| PubChem CID | 22119760 |
| Molecular Formula | C25H20ClNO5 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]azanium perchlorate |
| SMILES | [NH2+]=C1C=CC(=CC=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)C=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H19NO.ClHO4/c26-23-15-13-19(14-16-23)11-12-20-17-24(21-7-3-1-4-8-21)27-25(18-20)22-9-5-2-6-10-22;2-1(3,4)5/h1-18,26H;(H,2,3,4,5)/b19-11-,26-23?; |
| InChIKey | DZVDELZUSRUWIM-XDYCBUJBSA-N |
| XLogP | -0.48 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|