About 2-(1,2-thiazol-3-yl)acetate
2-(1,2-thiazol-3-yl)acetate (PubChem CID 22119909) has the molecular formula C5H4NO2S-
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-(1,2-thiazol-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(1,2-thiazol-3-yl)acetate |
| PubChem CID | 22119909 |
| Molecular Formula | C5H4NO2S- |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | 2-(1,2-thiazol-3-yl)acetate |
| SMILES | O=C([O-])Cc1ccsn1 |
| InChI | InChI=1S/C5H5NO2S/c7-5(8)3-4-1-2-9-6-4/h1-2H,3H2,(H,7,8)/p-1 |
| InChIKey | OHEYDQQAGOMBJA-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,2-thiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-thiazol-3-yl)acetate?
The IUPAC name of 2-(1,2-thiazol-3-yl)acetate (CID 22119909) is 2-(1,2-thiazol-3-yl)acetate.
What is the SMILES notation for 2-(1,2-thiazol-3-yl)acetate?
The canonical SMILES for 2-(1,2-thiazol-3-yl)acetate is O=C([O-])Cc1ccsn1.
What is the InChIKey of 2-(1,2-thiazol-3-yl)acetate?
The InChIKey is OHEYDQQAGOMBJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5NO2S/c7-5(8)3-4-1-2-9-6-4/h1-2H,3H2,(H,7,8)/p-1.
What are the key properties of 2-(1,2-thiazol-3-yl)acetate?
2-(1,2-thiazol-3-yl)acetate has a molecular weight of 142.16 g/mol, XLogP of -0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-thiazol-3-yl)acetate is sourced from PubChem (CID 22119909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).