About 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride
2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (PubChem CID 22120065) has the molecular formula C16H18Cl3N3
and a molecular weight of 358.70 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| PubChem CID | 22120065 |
| Molecular Formula | C16H18Cl3N3 |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| SMILES | CCc1cccc(N(C)/C(N)=N/c2cc(Cl)ccc2Cl)c1.Cl |
| InChI | InChI=1S/C16H17Cl2N3.ClH/c1-3-11-5-4-6-13(9-11)21(2)16(19)20-15-10-12(17)7-8-14(15)18;/h4-10H,3H2,1-2H3,(H2,19,20);1H |
| InChIKey | IPDCCWGHVGWSGH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
The IUPAC name of 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (CID 22120065) is 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
What is the SMILES notation for 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
The canonical SMILES for 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride is CCc1cccc(N(C)/C(N)=N/c2cc(Cl)ccc2Cl)c1.Cl.
What is the InChIKey of 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
The InChIKey is IPDCCWGHVGWSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N3.ClH/c1-3-11-5-4-6-13(9-11)21(2)16(19)20-15-10-12(17)7-8-14(15)18;/h4-10H,3H2,1-2H3,(H2,19,20);1H.
What are the key properties of 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride has a molecular weight of 358.70 g/mol, XLogP of 5.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dichlorophenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride is sourced from PubChem (CID 22120065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).