About 1-(cyclohexylmethyl)piperazine;dihydrochloride
1-(cyclohexylmethyl)piperazine;dihydrochloride (PubChem CID 22120190) has the molecular formula C11H24Cl2N2
and a molecular weight of 255.23 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)piperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)piperazine;dihydrochloride |
| PubChem CID | 22120190 |
| Molecular Formula | C11H24Cl2N2 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(cyclohexylmethyl)piperazine;dihydrochloride |
| SMILES | C1CCC(CN2CCNCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C11H22N2.2ClH/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;;/h11-12H,1-10H2;2*1H |
| InChIKey | VBHDFWIQTUHYEL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexylmethyl)piperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)piperazine;dihydrochloride?
The IUPAC name of 1-(cyclohexylmethyl)piperazine;dihydrochloride (CID 22120190) is 1-(cyclohexylmethyl)piperazine;dihydrochloride.
What is the SMILES notation for 1-(cyclohexylmethyl)piperazine;dihydrochloride?
The canonical SMILES for 1-(cyclohexylmethyl)piperazine;dihydrochloride is C1CCC(CN2CCNCC2)CC1.Cl.Cl.
What is the InChIKey of 1-(cyclohexylmethyl)piperazine;dihydrochloride?
The InChIKey is VBHDFWIQTUHYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.2ClH/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;;/h11-12H,1-10H2;2*1H.
What are the key properties of 1-(cyclohexylmethyl)piperazine;dihydrochloride?
1-(cyclohexylmethyl)piperazine;dihydrochloride has a molecular weight of 255.23 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)piperazine;dihydrochloride is sourced from PubChem (CID 22120190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).