C18H22N2OS2 — CID 22120425
8-(3-aminopropylsulfanyl)-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one (PubChem CID 22120425) has the molecular formula C18H22N2OS2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 8-(3-aminopropylsulfanyl)-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one.
| Compound Name | 8-(3-aminopropylsulfanyl)-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 22120425 |
| Molecular Formula | C18H22N2OS2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 8-(3-aminopropylsulfanyl)-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one |
| SMILES | CC1(C)CC(=O)c2c(SCCCN)ccc(-c3nccs3)c2C1 |
| InChI | InChI=1S/C18H22N2OS2/c1-18(2)10-13-12(17-20-7-9-23-17)4-5-15(22-8-3-6-19)16(13)14(21)11-18/h4-5,7,9H,3,6,8,10-11,19H2,1-2H3 |
| InChIKey | YCXPBCAFMDRAGL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|