About 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide
4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide (PubChem CID 2212069) has the molecular formula C21H26N2O2S
and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide |
| PubChem CID | 2212069 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCC(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C21H26N2O2S/c1-24-19-9-8-18(15-20(19)25-2)22-21(26)23-12-10-17(11-13-23)14-16-6-4-3-5-7-16/h3-9,15,17H,10-14H2,1-2H3,(H,22,26) |
| InChIKey | JACSNWHNOWBYNL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide?
The IUPAC name of 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide (CID 2212069) is 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide.
What is the SMILES notation for 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide?
The canonical SMILES for 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide is COc1ccc(NC(=S)N2CCC(Cc3ccccc3)CC2)cc1OC.
What is the InChIKey of 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide?
The InChIKey is JACSNWHNOWBYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2S/c1-24-19-9-8-18(15-20(19)25-2)22-21(26)23-12-10-17(11-13-23)14-16-6-4-3-5-7-16/h3-9,15,17H,10-14H2,1-2H3,(H,22,26).
What are the key properties of 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide?
4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide has a molecular weight of 370.52 g/mol, XLogP of 4.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(3,4-dimethoxyphenyl)piperidine-1-carbothioamide is sourced from PubChem (CID 2212069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).