C29H31FN2O7S — CID 22120954
ethyl 3-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[1-(phenylmethoxycarbamoyl)cyclobutyl]amino]propanoate (PubChem CID 22120954) has the molecular formula C29H31FN2O7S and a molecular weight of 570.64 g/mol. Its IUPAC name is ethyl 3-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[1-(phenylmethoxycarbamoyl)cyclobutyl]amino]propanoate.
| Compound Name | ethyl 3-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[1-(phenylmethoxycarbamoyl)cyclobutyl]amino]propanoate |
|---|---|
| PubChem CID | 22120954 |
| Molecular Formula | C29H31FN2O7S |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | ethyl 3-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[1-(phenylmethoxycarbamoyl)cyclobutyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(C1(C(=O)NOCc2ccccc2)CCC1)S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H31FN2O7S/c1-2-37-27(33)17-20-32(29(18-6-19-29)28(34)31-38-21-22-7-4-3-5-8-22)40(35,36)26-15-13-25(14-16-26)39-24-11-9-23(30)10-12-24/h3-5,7-16H,2,6,17-21H2,1H3,(H,31,34) |
| InChIKey | STNMXXYDUJCDDO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|