C9H10F4N2 — CID 22121159
N-tert-butyl-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 22121159) has the molecular formula C9H10F4N2 and a molecular weight of 222.18 g/mol. Its IUPAC name is N-tert-butyl-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-tert-butyl-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 22121159 |
| Molecular Formula | C9H10F4N2 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-tert-butyl-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CC(C)(C)Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C9H10F4N2/c1-9(2,3)15-6-4(10)7(12)14-8(13)5(6)11/h1-3H3,(H,14,15) |
| InChIKey | QMXGOPYRMLVJHL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|