C29H58O5Si2 — CID 22121312
3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid (PubChem CID 22121312) has the molecular formula C29H58O5Si2 and a molecular weight of 542.95 g/mol. Its IUPAC name is 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid.
| Compound Name | 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid |
|---|---|
| PubChem CID | 22121312 |
| Molecular Formula | C29H58O5Si2 |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid |
| SMILES | C=CCCCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)C(C)(C)C(CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H58O5Si2/c1-16-17-18-19-21(2)25(34-36(14,15)28(7,8)9)22(3)26(32)29(10,11)23(20-24(30)31)33-35(12,13)27(4,5)6/h16,21-23,25H,1,17-20H2,2-15H3,(H,30,31) |
| InChIKey | UHWJJPATWQNDHR-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|