About [3,5-dibromo-2-(bromomethyl)phenyl]methanol
[3,5-dibromo-2-(bromomethyl)phenyl]methanol (PubChem CID 22121392) has the molecular formula C8H7Br3O
and a molecular weight of 358.86 g/mol. Its IUPAC name is [3,5-dibromo-2-(bromomethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3,5-dibromo-2-(bromomethyl)phenyl]methanol |
| PubChem CID | 22121392 |
| Molecular Formula | C8H7Br3O |
| Molecular Weight | 358.86 g/mol |
| Exact Mass | 355.80 |
| IUPAC Name | [3,5-dibromo-2-(bromomethyl)phenyl]methanol |
| SMILES | OCc1cc(Br)cc(Br)c1CBr |
| InChI | InChI=1S/C8H7Br3O/c9-3-7-5(4-12)1-6(10)2-8(7)11/h1-2,12H,3-4H2 |
| InChIKey | DKAFKDOHRFFVPA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dibromo-2-(bromomethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dibromo-2-(bromomethyl)phenyl]methanol?
The IUPAC name of [3,5-dibromo-2-(bromomethyl)phenyl]methanol (CID 22121392) is [3,5-dibromo-2-(bromomethyl)phenyl]methanol.
What is the SMILES notation for [3,5-dibromo-2-(bromomethyl)phenyl]methanol?
The canonical SMILES for [3,5-dibromo-2-(bromomethyl)phenyl]methanol is OCc1cc(Br)cc(Br)c1CBr.
What is the InChIKey of [3,5-dibromo-2-(bromomethyl)phenyl]methanol?
The InChIKey is DKAFKDOHRFFVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br3O/c9-3-7-5(4-12)1-6(10)2-8(7)11/h1-2,12H,3-4H2.
What are the key properties of [3,5-dibromo-2-(bromomethyl)phenyl]methanol?
[3,5-dibromo-2-(bromomethyl)phenyl]methanol has a molecular weight of 358.86 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dibromo-2-(bromomethyl)phenyl]methanol is sourced from PubChem (CID 22121392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).