About 2-butyl-1H-benzimidazole
2-butyl-1H-benzimidazole (PubChem CID 22122) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-butyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-butyl-1H-benzimidazole |
| PubChem CID | 22122 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-butyl-1H-benzimidazole |
| SMILES | CCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H14N2/c1-2-3-8-11-12-9-6-4-5-7-10(9)13-11/h4-7H,2-3,8H2,1H3,(H,12,13) |
| InChIKey | HITWHALOZBMLHY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1H-benzimidazole?
The IUPAC name of 2-butyl-1H-benzimidazole (CID 22122) is 2-butyl-1H-benzimidazole.
What is the SMILES notation for 2-butyl-1H-benzimidazole?
The canonical SMILES for 2-butyl-1H-benzimidazole is CCCCc1nc2ccccc2[nH]1.
What is the InChIKey of 2-butyl-1H-benzimidazole?
The InChIKey is HITWHALOZBMLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-3-8-11-12-9-6-4-5-7-10(9)13-11/h4-7H,2-3,8H2,1H3,(H,12,13).
What are the key properties of 2-butyl-1H-benzimidazole?
2-butyl-1H-benzimidazole has a molecular weight of 174.25 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-benzimidazole is sourced from PubChem (CID 22122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).