About benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate
benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate (PubChem CID 22122257) has the molecular formula C28H30N4O4
and a molecular weight of 486.57 g/mol. Its IUPAC name is benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate.
Molecular Properties
| Compound Name | benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate |
| PubChem CID | 22122257 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate |
| SMILES | NCCCN1CCN(C(CC(=O)OC(c2ccccc2)c2ccccc2)c2cccnc2)C(=O)C1=O |
| InChI | InChI=1S/C28H30N4O4/c29-14-8-16-31-17-18-32(28(35)27(31)34)24(23-13-7-15-30-20-23)19-25(33)36-26(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-7,9-13,15,20,24,26H,8,14,16-19,29H2 |
| InChIKey | RRZRVHVVWPSBSU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate?
The IUPAC name of benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate (CID 22122257) is benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate.
What is the SMILES notation for benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate?
The canonical SMILES for benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate is NCCCN1CCN(C(CC(=O)OC(c2ccccc2)c2ccccc2)c2cccnc2)C(=O)C1=O.
What is the InChIKey of benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate?
The InChIKey is RRZRVHVVWPSBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N4O4/c29-14-8-16-31-17-18-32(28(35)27(31)34)24(23-13-7-15-30-20-23)19-25(33)36-26(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-7,9-13,15,20,24,26H,8,14,16-19,29H2.
What are the key properties of benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate?
benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate has a molecular weight of 486.57 g/mol, XLogP of 2.87, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl 3-[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl]-3-pyridin-3-ylpropanoate is sourced from PubChem (CID 22122257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).