C20H19F4N5O — CID 22122356
4-(3-fluoro-4-piperazin-1-ylphenyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 22122356) has the molecular formula C20H19F4N5O and a molecular weight of 421.40 g/mol. Its IUPAC name is 4-(3-fluoro-4-piperazin-1-ylphenyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 4-(3-fluoro-4-piperazin-1-ylphenyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 22122356 |
| Molecular Formula | C20H19F4N5O |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-(3-fluoro-4-piperazin-1-ylphenyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(-c2ccc(N3CCNCC3)c(F)c2)cnn1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F4N5O/c21-17-11-16(5-6-18(17)27-9-7-25-8-10-27)28-13-26-29(19(28)30)12-14-1-3-15(4-2-14)20(22,23)24/h1-6,11,13,25H,7-10,12H2 |
| InChIKey | AAEMFSIEXGODIH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|