C33H34N8O4 — CID 22122434
(E)-N-(3-morpholin-4-ylpropyl)-N'-[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enediamide (PubChem CID 22122434) has the molecular formula C33H34N8O4 and a molecular weight of 606.69 g/mol. Its IUPAC name is (E)-N-(3-morpholin-4-ylpropyl)-N'-[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enediamide.
| Compound Name | (E)-N-(3-morpholin-4-ylpropyl)-N'-[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enediamide |
|---|---|
| PubChem CID | 22122434 |
| Molecular Formula | C33H34N8O4 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (E)-N-(3-morpholin-4-ylpropyl)-N'-[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enediamide |
| SMILES | O=C(/C=C/C(=O)Nc1cc2c(Nc3ccc4[nH]c(OCc5ccccc5)cc4c3)ncnc2cn1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C33H34N8O4/c42-30(34-11-4-12-41-13-15-44-16-14-41)9-10-31(43)40-29-19-26-28(20-35-29)36-22-37-33(26)38-25-7-8-27-24(17-25)18-32(39-27)45-21-23-5-2-1-3-6-23/h1-3,5-10,17-20,22,39H,4,11-16,21H2,(H,34,42)(H,35,40,43)(H,36,37,38)/b10-9+ |
| InChIKey | HSXZTPKJJXUJEN-MDZDMXLPSA-N |
| XLogP | 4.16 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|