About 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one
1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one (PubChem CID 22122683) has the molecular formula C17H16FNO2
and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one |
| PubChem CID | 22122683 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one |
| SMILES | CC1=C(n2ccccc2=O)c2cc(F)ccc2OC1(C)C |
| InChI | InChI=1S/C17H16FNO2/c1-11-16(19-9-5-4-6-15(19)20)13-10-12(18)7-8-14(13)21-17(11,2)3/h4-10H,1-3H3 |
| InChIKey | XYKCZSNRHZRPDS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one?
The IUPAC name of 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one (CID 22122683) is 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one.
What is the SMILES notation for 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one?
The canonical SMILES for 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one is CC1=C(n2ccccc2=O)c2cc(F)ccc2OC1(C)C.
What is the InChIKey of 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one?
The InChIKey is XYKCZSNRHZRPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO2/c1-11-16(19-9-5-4-6-15(19)20)13-10-12(18)7-8-14(13)21-17(11,2)3/h4-10H,1-3H3.
What are the key properties of 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one?
1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one has a molecular weight of 285.32 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluoro-2,2,3-trimethylchromen-4-yl)pyridin-2-one is sourced from PubChem (CID 22122683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).