About [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate
[1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate (PubChem CID 22122800) has the molecular formula C19H18N2O5
and a molecular weight of 354.36 g/mol. Its IUPAC name is [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate.
Molecular Properties
| Compound Name | [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate |
| PubChem CID | 22122800 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate |
| SMILES | CC(=O)Oc1ccn(C2c3cc(C#N)ccc3OC(C)(C)C2O)c(=O)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-11(22)25-13-6-7-21(16(23)9-13)17-14-8-12(10-20)4-5-15(14)26-19(2,3)18(17)24/h4-9,17-18,24H,1-3H3 |
| InChIKey | OCPOWGADCNPLSZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate?
The IUPAC name of [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate (CID 22122800) is [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate.
What is the SMILES notation for [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate?
The canonical SMILES for [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate is CC(=O)Oc1ccn(C2c3cc(C#N)ccc3OC(C)(C)C2O)c(=O)c1.
What is the InChIKey of [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate?
The InChIKey is OCPOWGADCNPLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5/c1-11(22)25-13-6-7-21(16(23)9-13)17-14-8-12(10-20)4-5-15(14)26-19(2,3)18(17)24/h4-9,17-18,24H,1-3H3.
What are the key properties of [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate?
[1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate has a molecular weight of 354.36 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-oxo-4-pyridinyl] acetate is sourced from PubChem (CID 22122800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).