C37H25BrN4O4 — CID 22123315
2-[4-bromo-3-[[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]methyl]phenyl]-4-methylisoindole-1,3-dione (PubChem CID 22123315) has the molecular formula C37H25BrN4O4 and a molecular weight of 669.54 g/mol. Its IUPAC name is 2-[4-bromo-3-[[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]methyl]phenyl]-4-methylisoindole-1,3-dione.
| Compound Name | 2-[4-bromo-3-[[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]methyl]phenyl]-4-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 22123315 |
| Molecular Formula | C37H25BrN4O4 |
| Molecular Weight | 669.54 g/mol |
| Exact Mass | 668.11 |
| IUPAC Name | 2-[4-bromo-3-[[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]methyl]phenyl]-4-methylisoindole-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)N(c1ccc(Br)c(Cn3cc(C4=C(c5cn(C)c6ccccc56)C(=O)NC4=O)c4ccccc43)c1)C2=O |
| InChI | InChI=1S/C37H25BrN4O4/c1-20-8-7-11-25-31(20)37(46)42(36(25)45)22-14-15-28(38)21(16-22)17-41-19-27(24-10-4-6-13-30(24)41)33-32(34(43)39-35(33)44)26-18-40(2)29-12-5-3-9-23(26)29/h3-16,18-19H,17H2,1-2H3,(H,39,43,44) |
| InChIKey | GSTONCMHUNOPDT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|