About N-(1,3-dimethoxybutyl)acetamide
N-(1,3-dimethoxybutyl)acetamide (PubChem CID 22123473) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(1,3-dimethoxybutyl)acetamide.
Molecular Properties
| Compound Name | N-(1,3-dimethoxybutyl)acetamide |
| PubChem CID | 22123473 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N-(1,3-dimethoxybutyl)acetamide |
| SMILES | COC(C)CC(NC(C)=O)OC |
| InChI | InChI=1S/C8H17NO3/c1-6(11-3)5-8(12-4)9-7(2)10/h6,8H,5H2,1-4H3,(H,9,10) |
| InChIKey | CBDNDJXWGVSTBX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dimethoxybutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dimethoxybutyl)acetamide?
The IUPAC name of N-(1,3-dimethoxybutyl)acetamide (CID 22123473) is N-(1,3-dimethoxybutyl)acetamide.
What is the SMILES notation for N-(1,3-dimethoxybutyl)acetamide?
The canonical SMILES for N-(1,3-dimethoxybutyl)acetamide is COC(C)CC(NC(C)=O)OC.
What is the InChIKey of N-(1,3-dimethoxybutyl)acetamide?
The InChIKey is CBDNDJXWGVSTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-6(11-3)5-8(12-4)9-7(2)10/h6,8H,5H2,1-4H3,(H,9,10).
What are the key properties of N-(1,3-dimethoxybutyl)acetamide?
N-(1,3-dimethoxybutyl)acetamide has a molecular weight of 175.23 g/mol, XLogP of 0.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dimethoxybutyl)acetamide is sourced from PubChem (CID 22123473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).