About 1-methylpyridin-1-ium phenoxide
1-methylpyridin-1-ium phenoxide (PubChem CID 22123483) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-methylpyridin-1-ium phenoxide.
Molecular Properties
| Compound Name | 1-methylpyridin-1-ium phenoxide |
| PubChem CID | 22123483 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-methylpyridin-1-ium phenoxide |
| SMILES | C[n+]1ccccc1.[O-]c1ccccc1 |
| InChI | InChI=1S/C6H8N.C6H6O/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6/h2-6H,1H3;1-5,7H/q+1;/p-1 |
| InChIKey | LJGJUJUCRKQQSA-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyridin-1-ium phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyridin-1-ium phenoxide?
The IUPAC name of 1-methylpyridin-1-ium phenoxide (CID 22123483) is 1-methylpyridin-1-ium phenoxide.
What is the SMILES notation for 1-methylpyridin-1-ium phenoxide?
The canonical SMILES for 1-methylpyridin-1-ium phenoxide is C[n+]1ccccc1.[O-]c1ccccc1.
What is the InChIKey of 1-methylpyridin-1-ium phenoxide?
The InChIKey is LJGJUJUCRKQQSA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8N.C6H6O/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6/h2-6H,1H3;1-5,7H/q+1;/p-1.
What are the key properties of 1-methylpyridin-1-ium phenoxide?
1-methylpyridin-1-ium phenoxide has a molecular weight of 187.24 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyridin-1-ium phenoxide is sourced from PubChem (CID 22123483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).