About 1-(4-chlorophenyl)-1,2,4-triazolidine
1-(4-chlorophenyl)-1,2,4-triazolidine (PubChem CID 22123541) has the molecular formula C8H10ClN3
and a molecular weight of 183.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1,2,4-triazolidine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-1,2,4-triazolidine |
| PubChem CID | 22123541 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 1-(4-chlorophenyl)-1,2,4-triazolidine |
| SMILES | Clc1ccc(N2CNCN2)cc1 |
| InChI | InChI=1S/C8H10ClN3/c9-7-1-3-8(4-2-7)12-6-10-5-11-12/h1-4,10-11H,5-6H2 |
| InChIKey | WSVKRCBAIODSRF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-1,2,4-triazolidine?
The IUPAC name of 1-(4-chlorophenyl)-1,2,4-triazolidine (CID 22123541) is 1-(4-chlorophenyl)-1,2,4-triazolidine.
What is the SMILES notation for 1-(4-chlorophenyl)-1,2,4-triazolidine?
The canonical SMILES for 1-(4-chlorophenyl)-1,2,4-triazolidine is Clc1ccc(N2CNCN2)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-1,2,4-triazolidine?
The InChIKey is WSVKRCBAIODSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3/c9-7-1-3-8(4-2-7)12-6-10-5-11-12/h1-4,10-11H,5-6H2.
What are the key properties of 1-(4-chlorophenyl)-1,2,4-triazolidine?
1-(4-chlorophenyl)-1,2,4-triazolidine has a molecular weight of 183.64 g/mol, XLogP of 1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-1,2,4-triazolidine is sourced from PubChem (CID 22123541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).