C32H35F5O5S2 — CID 22123577
3-(4-hydroxyphenyl)-3-methyl-4-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 22123577) has the molecular formula C32H35F5O5S2 and a molecular weight of 658.75 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 22123577 |
| Molecular Formula | C32H35F5O5S2 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1c1ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H35F5O5S2/c1-30(23-8-10-24(38)11-9-23)21-43-28-20-25(39)12-15-27(28)29(30)22-6-13-26(14-7-22)42-17-3-2-4-18-44(40,41)19-5-16-31(33,34)32(35,36)37/h6-15,20,29,38-39H,2-5,16-19,21H2,1H3 |
| InChIKey | BPEVZWYUUMAFPC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|