C18H42O2Si4 — CID 22123658
[2-(2,2-dimethylpropyl)-3-methyl-1,1-bis(trimethylsilyloxy)-2H-silet-4-yl]-trimethylsilane (PubChem CID 22123658) has the molecular formula C18H42O2Si4 and a molecular weight of 402.88 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)-3-methyl-1,1-bis(trimethylsilyloxy)-2H-silet-4-yl]-trimethylsilane.
| Compound Name | [2-(2,2-dimethylpropyl)-3-methyl-1,1-bis(trimethylsilyloxy)-2H-silet-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 22123658 |
| Molecular Formula | C18H42O2Si4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [2-(2,2-dimethylpropyl)-3-methyl-1,1-bis(trimethylsilyloxy)-2H-silet-4-yl]-trimethylsilane |
| SMILES | CC1=C([Si](C)(C)C)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)C1CC(C)(C)C |
| InChI | InChI=1S/C18H42O2Si4/c1-15-16(14-18(2,3)4)24(19-22(8,9)10,20-23(11,12)13)17(15)21(5,6)7/h16H,14H2,1-13H3 |
| InChIKey | QRFJYCRMLSQVHL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|