About [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane
[2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane (PubChem CID 22123659) has the molecular formula C16H36O2Si3
and a molecular weight of 344.72 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane |
| PubChem CID | 22123659 |
| Molecular Formula | C16H36O2Si3 |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane |
| SMILES | CC1=C(C)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)C1CC(C)(C)C |
| InChI | InChI=1S/C16H36O2Si3/c1-13-14(2)21(17-19(6,7)8,18-20(9,10)11)15(13)12-16(3,4)5/h15H,12H2,1-11H3 |
| InChIKey | WDHQXSWOVUXCLA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane?
The IUPAC name of [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane (CID 22123659) is [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane.
What is the SMILES notation for [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane?
The canonical SMILES for [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane is CC1=C(C)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)C1CC(C)(C)C.
What is the InChIKey of [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane?
The InChIKey is WDHQXSWOVUXCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36O2Si3/c1-13-14(2)21(17-19(6,7)8,18-20(9,10)11)15(13)12-16(3,4)5/h15H,12H2,1-11H3.
What are the key properties of [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane?
[2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane has a molecular weight of 344.72 g/mol, XLogP of 5.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-dimethylpropyl)-3,4-dimethyl-1-trimethylsilyloxy-2H-silet-1-yl]oxy-trimethylsilane is sourced from PubChem (CID 22123659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).