About 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane
6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 22123812) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane |
| PubChem CID | 22123812 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | COC1C2CC(C1OC)C1OC21 |
| InChI | InChI=1S/C9H14O3/c1-10-6-4-3-5(7(6)11-2)9-8(4)12-9/h4-9H,3H2,1-2H3 |
| InChIKey | ILJPVWNVBYIOIP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane?
The IUPAC name of 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane (CID 22123812) is 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane.
What is the SMILES notation for 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane?
The canonical SMILES for 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane is COC1C2CC(C1OC)C1OC21.
What is the InChIKey of 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane?
The InChIKey is ILJPVWNVBYIOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-10-6-4-3-5(7(6)11-2)9-8(4)12-9/h4-9H,3H2,1-2H3.
What are the key properties of 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane?
6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane has a molecular weight of 170.21 g/mol, XLogP of 0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3-oxatricyclo[3.2.1.02,4]octane is sourced from PubChem (CID 22123812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).