About hexyl naphthalene-2-carboxylate
hexyl naphthalene-2-carboxylate (PubChem CID 22123818) has the molecular formula C17H20O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is hexyl naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | hexyl naphthalene-2-carboxylate |
| PubChem CID | 22123818 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | hexyl naphthalene-2-carboxylate |
| SMILES | CCCCCCOC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20O2/c1-2-3-4-7-12-19-17(18)16-11-10-14-8-5-6-9-15(14)13-16/h5-6,8-11,13H,2-4,7,12H2,1H3 |
| InChIKey | KPHPYUONJZYCOY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl naphthalene-2-carboxylate?
The IUPAC name of hexyl naphthalene-2-carboxylate (CID 22123818) is hexyl naphthalene-2-carboxylate.
What is the SMILES notation for hexyl naphthalene-2-carboxylate?
The canonical SMILES for hexyl naphthalene-2-carboxylate is CCCCCCOC(=O)c1ccc2ccccc2c1.
What is the InChIKey of hexyl naphthalene-2-carboxylate?
The InChIKey is KPHPYUONJZYCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2/c1-2-3-4-7-12-19-17(18)16-11-10-14-8-5-6-9-15(14)13-16/h5-6,8-11,13H,2-4,7,12H2,1H3.
What are the key properties of hexyl naphthalene-2-carboxylate?
hexyl naphthalene-2-carboxylate has a molecular weight of 256.35 g/mol, XLogP of 4.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl naphthalene-2-carboxylate is sourced from PubChem (CID 22123818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).