About ethyl 4-(oxiran-2-yl)benzoate
ethyl 4-(oxiran-2-yl)benzoate (PubChem CID 22123819) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is ethyl 4-(oxiran-2-yl)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(oxiran-2-yl)benzoate |
| PubChem CID | 22123819 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | ethyl 4-(oxiran-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C11H12O3/c1-2-13-11(12)9-5-3-8(4-6-9)10-7-14-10/h3-6,10H,2,7H2,1H3 |
| InChIKey | NFTQEQRAKJRPEW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(oxiran-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(oxiran-2-yl)benzoate?
The IUPAC name of ethyl 4-(oxiran-2-yl)benzoate (CID 22123819) is ethyl 4-(oxiran-2-yl)benzoate.
What is the SMILES notation for ethyl 4-(oxiran-2-yl)benzoate?
The canonical SMILES for ethyl 4-(oxiran-2-yl)benzoate is CCOC(=O)c1ccc(C2CO2)cc1.
What is the InChIKey of ethyl 4-(oxiran-2-yl)benzoate?
The InChIKey is NFTQEQRAKJRPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-2-13-11(12)9-5-3-8(4-6-9)10-7-14-10/h3-6,10H,2,7H2,1H3.
What are the key properties of ethyl 4-(oxiran-2-yl)benzoate?
ethyl 4-(oxiran-2-yl)benzoate has a molecular weight of 192.21 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(oxiran-2-yl)benzoate is sourced from PubChem (CID 22123819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).