C28H40N4O3 — CID 22124658
7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-ethyl-1,6-naphthyridin-2-one (PubChem CID 22124658) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is 7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-ethyl-1,6-naphthyridin-2-one.
| Compound Name | 7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-ethyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124658 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-ethyl-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCCCNc1cc2c(cn1)cc(-c1c(C)c(OC)cc(OC)c1C)c(=O)n2CC |
| InChI | InChI=1S/C28H40N4O3/c1-8-31(9-2)14-12-11-13-29-26-16-23-21(18-30-26)15-22(28(33)32(23)10-3)27-19(4)24(34-6)17-25(35-7)20(27)5/h15-18H,8-14H2,1-7H3,(H,29,30) |
| InChIKey | LKTRHJQMXVXUMT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|